| Name | 4-ethylguaiacol |
| Synonyms | FEMA 2436 HOMOVANILLIN ETHYL GUAIACOL 4-ETHYLGUAIACOL 4-ethylguaiacol 4-ethyl guiacol 4-ethvlguaiacol 4-ETHYL-2-METHOXYPHENOL |
| CAS | 2785-89-9 |
| EINECS | 220-500-4 |
| InChI | InChI=1/C9H12O2/c1-3-7-4-5-8(10)9(6-7)11-2/h4-6,10H,3H2,1-2H3 |
| Molecular Formula | C9H12O2 |
| Molar Mass | 152.19 |
| Density | 1.051g/cm3 |
| Melting Point | 15℃ |
| Boling Point | 246.5°C at 760 mmHg |
| Flash Point | 107.8°C |
| Vapor Presure | 0.0173mmHg at 25°C |
| Appearance | Transparent liquid |
| Storage Condition | 2-8℃ |
| Refractive Index | 1.525 |
| MDL | MFCD00038714 |
| Physical and Chemical Properties | Chemical properties colorless to light yellow oily liquid. Sweet and warm spices and herbs are fragrant. Boiling point 229~235 ℃. Slightly soluble in water, miscible in oil and ethanol. |
| Use | Used as food additives and spices |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R22 - Harmful if swallowed R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| UN IDs | 2810 |
colorless oily liquid. Molecular Weight 152. 19, boiling point 234~236 ℃, Flash Point 107 ℃, with a spicy flavor. Soluble in ethanol, acetone and other organic solvents.
It is obtained by fractionation of wood tar as raw material or by chemical synthesis of guaiacol.
| WGK Germany | 2 |
| TSCA | Yes |
| HazardClass | 6.1( B ) |
| PackingGroup | III |
| customs code | 29071990 |
content analysis
Gas chromatographic analysis with polar columns as GT-10-4.
Toxicity
GRAS(FEMA; FDA,& sect;172.515;2000).
use limited
FEMA(mg/kg): beverage 0.05; Ice cream 1.1; Pudding and gelatin 0.23.
Moderate limit (FDA,& sect;172.515,2000).
production method
it is obtained by distilling 229~230 ℃ from wood tar.
| FEMA | 2436 | 4-ETHYLGUAIACOL |
| refractive index | n20/D 1.528(lit.) |
| flash point | 226 °F |
| storage conditions | 2-8°C |
| acidity coefficient (pKa) | 10.31±0.18(Predicted) |
| morphology | Liquid |
| color | Clear colorless to light yellow |
| Specific gravity | 1.06 |
| JECFA Number | 716 |
| BRN | 2045329 |
| NIST chemical information | Phenol, 4-ethyl-2-methoxy-(2785-89-9) |
| EPA chemical information | Phenol, 4-ethyl-2-methoxy- (2785-89-9) |